CAS 1049706-69-5 appears in our catalog under these names: 6-Chloro-3-nitro-2-phenylpyridine, 95%, 6-Chloro-3-nitro-2-phenylpyridine. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 50mg, 0,5g.
6-chloro-3-nitro-2-phenylpyridine (CAS 1049706-69-5) is a chemical compound with the molecular formula C11H7ClN2O2 and a molecular weight of 234.64 g/mol. IUPAC name: 6-chloro-3-nitro-2-phenylpyridine. InChIKey: IGMJZXTVWRCLKZ-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2O2 |
|---|---|
| Molecular weight | 234.64 g/mol |
| IUPAC name | 6-chloro-3-nitro-2-phenylpyridine |
| InChIKey | IGMJZXTVWRCLKZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC(=N2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)