Products 914349-46-5
CAS 914349-46-5 appears in our catalog under these names: 3-(6-Chloropyridazin-3-yl)benzoic acid, 95%, 3-(6-Chloropyridazin-3-yl)benzoic acid, 95-<97%, 3-(6-Chloropyridazin-3-yl)benzoic acid, ≥97-<99%. Offered by: Combi-blocks, Hoffman Fine Chemicals. Available pack sizes: 1g, 250mg, 5g, 10g, 25g, 50g, 100g.
3-(6-chloropyridazin-3-yl)benzoic acid (CAS 914349-46-5) is a chemical compound with the molecular formula C11H7ClN2O2 and a molecular weight of 234.64 g/mol. IUPAC name: 3-(6-chloropyridazin-3-yl)benzoic acid. InChIKey: UNZBOMFXUMHBFC-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2O2 |
|---|---|
| Molecular weight | 234.64 g/mol |
| IUPAC name | 3-(6-chloropyridazin-3-yl)benzoic acid |
| InChIKey | UNZBOMFXUMHBFC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(=O)O)C2=NN=C(C=C2)Cl |
Computed by PubChem (NCBI)