CAS 1258850-50-8 appears in our catalog under these names: 6-(4-Chlorophenyl)pyrazine-2-carboxylic acid, 95%, 6–(4–Chlorophenyl)pyrazine–2–carboxylic Acid. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
6-(4-chlorophenyl)pyrazine-2-carboxylic acid (CAS 1258850-50-8) is a chemical compound with the molecular formula C11H7ClN2O2 and a molecular weight of 234.64 g/mol. IUPAC name: 6-(4-chlorophenyl)pyrazine-2-carboxylic acid. InChIKey: BRONFCRDDFHGKC-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2O2 |
|---|---|
| Molecular weight | 234.64 g/mol |
| IUPAC name | 6-(4-chlorophenyl)pyrazine-2-carboxylic acid |
| InChIKey | BRONFCRDDFHGKC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=CC(=N2)C(=O)O)Cl |
Computed by PubChem (NCBI)