CAS 945600-13-5 is the registry number for 3-Chloro-6-phenylpyridazine-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg.
3-chloro-6-phenylpyridazine-4-carboxylic acid (CAS 945600-13-5) is a chemical compound with the molecular formula C11H7ClN2O2 and a molecular weight of 234.64 g/mol. IUPAC name: 3-chloro-6-phenylpyridazine-4-carboxylic acid. InChIKey: SPWKYXOBPSZEGK-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2O2 |
|---|---|
| Molecular weight | 234.64 g/mol |
| IUPAC name | 3-chloro-6-phenylpyridazine-4-carboxylic acid |
| InChIKey | SPWKYXOBPSZEGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(C(=C2)C(=O)O)Cl |
Computed by PubChem (NCBI)