CAS 80550-76-1 appears in our catalog under these names: 2-(Chloromethyl)[1]benzofuro[3,2-d]pyrimidin-4(3h)-one, 95%, 2-(Chloromethyl)benzofuro(3,2-d)pyrimidin-4(3H)-one, 97%, 4-(Chloromethyl)-8-oxa-3,5-diazatricyclo(7.4.0.0,2,7)trideca-1(13),2(7),3,9,11-pentaen-6-one. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg, 0,5g.
2-(chloromethyl)-3H-[1]benzofuro[3,2-d]pyrimidin-4-one (CAS 80550-76-1) is a chemical compound with the molecular formula C11H7ClN2O2 and a molecular weight of 234.64 g/mol. IUPAC name: 2-(chloromethyl)-3H-[1]benzofuro[3,2-d]pyrimidin-4-one. InChIKey: UTFOEOBMLILAKL-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2O2 |
|---|---|
| Molecular weight | 234.64 g/mol |
| IUPAC name | 2-(chloromethyl)-3H-[1]benzofuro[3,2-d]pyrimidin-4-one |
| InChIKey | UTFOEOBMLILAKL-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C(=O)NC(=N3)CCl |
Computed by PubChem (NCBI)