Products 845827-17-0
CAS 845827-17-0 appears in our catalog under these names: 4-(6-Chloropyridazin-3-yl)benzoic acid, 95%, 4-(6-Chloropyridazin-3-yl)benzoic acid, >95%, >95%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 1g.
4-(6-chloropyridazin-3-yl)benzoic acid (CAS 845827-17-0) is a chemical compound with the molecular formula C11H7ClN2O2 and a molecular weight of 234.64 g/mol. IUPAC name: 4-(6-chloropyridazin-3-yl)benzoic acid. InChIKey: KFIYDCWKTZPYHH-UHFFFAOYSA-N.
| Molecular formula | C11H7ClN2O2 |
|---|---|
| Molecular weight | 234.64 g/mol |
| IUPAC name | 4-(6-chloropyridazin-3-yl)benzoic acid |
| InChIKey | KFIYDCWKTZPYHH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NN=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)