CAS 1049873-28-0 is the registry number for Dimethyl({(3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl)methyl})amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N,N-dimethyl-1-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methanamine (CAS 1049873-28-0) is a chemical compound with the molecular formula C11H12N4O3 and a molecular weight of 248.24 g/mol. IUPAC name: N,N-dimethyl-1-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methanamine. InChIKey: CEQVOOGLHNALOH-UHFFFAOYSA-N.
| Molecular formula | C11H12N4O3 |
|---|---|
| Molecular weight | 248.24 g/mol |
| IUPAC name | N,N-dimethyl-1-[3-(4-nitrophenyl)-1,2,4-oxadiazol-5-yl]methanamine |
| InChIKey | CEQVOOGLHNALOH-UHFFFAOYSA-N |
| SMILES | CN(C)CC1=NC(=NO1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)