Products 1870824-79-5
CAS 1870824-79-5 is the registry number for Finerenone Impurity 24. Offered by: Chemat Brand. Available pack sizes: on request.
2-cyanoethyl (2E)-2-[(4-cyano-2-methoxyphenyl)methylidene]-3-oxobutanoate (CAS 1870824-79-5) is a chemical compound with the molecular formula C16H14N2O4 and a molecular weight of 298.29 g/mol. IUPAC name: 2-cyanoethyl (2E)-2-[(4-cyano-2-methoxyphenyl)methylidene]-3-oxobutanoate. InChIKey: RFJLQSVKIAMLCX-NTEUORMPSA-N.
| Molecular formula | C16H14N2O4 |
|---|---|
| Molecular weight | 298.29 g/mol |
| IUPAC name | 2-cyanoethyl (2E)-2-[(4-cyano-2-methoxyphenyl)methylidene]-3-oxobutanoate |
| InChIKey | RFJLQSVKIAMLCX-NTEUORMPSA-N |
| SMILES | CC(=O)/C(=C\C1=C(C=C(C=C1)C#N)OC)/C(=O)OCCC#N |
Computed by PubChem (NCBI)