CAS 1050610-67-7 appears in our catalog under these names: Methyl 3-(aminomethyl)picolinate hydrochloride, 97%, Methyl 3-(aminomethyl)picolinate hydrochloride, 97%, 97%, Methyl3-(aminomethyl)pyridine-2-carboxylate,hydrochloride, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 500mg.
Methyl 3-(aminomethyl)pyridine-2-carboxylate;hydrochloride (CAS 1050610-67-7) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: methyl 3-(aminomethyl)pyridine-2-carboxylate;hydrochloride. InChIKey: KNPNDLVSSZILGW-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | methyl 3-(aminomethyl)pyridine-2-carboxylate;hydrochloride |
| InChIKey | KNPNDLVSSZILGW-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC=N1)CN.Cl |
Computed by PubChem (NCBI)