Products 105062-36-0
CAS 105062-36-0 is the registry number for 1-Ketoaethiopinone. Offered by: Biosynth, MedChemExpress. Available pack sizes: 25mg, 10mg, 50mg, Get quote.
7-methyl-8-(4-methylpent-4-enoyl)-3-propan-2-ylnaphthalene-1,2-dione (CAS 105062-36-0) is a chemical compound with the molecular formula C20H22O3 and a molecular weight of 310.4 g/mol. IUPAC name: 7-methyl-8-(4-methylpent-4-enoyl)-3-propan-2-ylnaphthalene-1,2-dione. InChIKey: QBFJRHHNMGXMEF-UHFFFAOYSA-N.
| Molecular formula | C20H22O3 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 7-methyl-8-(4-methylpent-4-enoyl)-3-propan-2-ylnaphthalene-1,2-dione |
| InChIKey | QBFJRHHNMGXMEF-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C=C(C(=O)C2=O)C(C)C)C(=O)CCC(=C)C |
Computed by PubChem (NCBI)