Products 1519-21-7

CAS 1519-21-7 is the registry number for 2-Phenylbutyric acid anhydride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

2-phenylbutanoyl 2-phenylbutanoate (CAS 1519-21-7) is a chemical compound with the molecular formula C20H22O3 and a molecular weight of 310.4 g/mol. IUPAC name: 2-phenylbutanoyl 2-phenylbutanoate. InChIKey: NMVCQWBTTHDUQD-UHFFFAOYSA-N.

Identity
Molecular formulaC20H22O3
Molecular weight310.4 g/mol
IUPAC name2-phenylbutanoyl 2-phenylbutanoate
InChIKeyNMVCQWBTTHDUQD-UHFFFAOYSA-N
SMILESCCC(C1=CC=CC=C1)C(=O)OC(=O)C(CC)C2=CC=CC=C2

Computed by PubChem (NCBI)