CAS 66320-32-9 is the registry number for trans-Diethyl Stilbestrol Acetate. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.
[4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenyl] acetate (CAS 66320-32-9) is a chemical compound with the molecular formula C20H22O3 and a molecular weight of 310.4 g/mol. IUPAC name: [4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenyl] acetate. InChIKey: KRQVPGASQFBKSX-FMQUCBEESA-N.
| Molecular formula | C20H22O3 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | [4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenyl] acetate |
| InChIKey | KRQVPGASQFBKSX-FMQUCBEESA-N |
| SMILES | CC/C(=C(/CC)\C1=CC=C(C=C1)OC(=O)C)/C2=CC=C(C=C2)O |
Computed by PubChem (NCBI)