Products 66320-32-9

CAS 66320-32-9 is the registry number for trans-Diethyl Stilbestrol Acetate. Offered by: TRC. Available pack sizes: 100mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

[4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenyl] acetate (CAS 66320-32-9) is a chemical compound with the molecular formula C20H22O3 and a molecular weight of 310.4 g/mol. IUPAC name: [4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenyl] acetate. InChIKey: KRQVPGASQFBKSX-FMQUCBEESA-N.

Identity
Molecular formulaC20H22O3
Molecular weight310.4 g/mol
IUPAC name[4-[(E)-4-(4-hydroxyphenyl)hex-3-en-3-yl]phenyl] acetate
InChIKeyKRQVPGASQFBKSX-FMQUCBEESA-N
SMILESCC/C(=C(/CC)\C1=CC=C(C=C1)OC(=O)C)/C2=CC=C(C=C2)O

Computed by PubChem (NCBI)