Products 2002455-72-1
CAS 2002455-72-1 is the registry number for Sacubitril Impurity 89. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
Ethyl (2R)-2-methyl-4-oxo-5-(4-phenylphenyl)pentanoate (CAS 2002455-72-1) is a chemical compound with the molecular formula C20H22O3 and a molecular weight of 310.4 g/mol. IUPAC name: ethyl (2R)-2-methyl-4-oxo-5-(4-phenylphenyl)pentanoate. InChIKey: AOLCOHGAOUBTPP-OAHLLOKOSA-N.
| Molecular formula | C20H22O3 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | ethyl (2R)-2-methyl-4-oxo-5-(4-phenylphenyl)pentanoate |
| InChIKey | AOLCOHGAOUBTPP-OAHLLOKOSA-N |
| SMILES | CCOC(=O)[C@H](C)CC(=O)CC1=CC=C(C=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)