CAS 850753-00-3 is the registry number for (2R,3S) 3-Benzyloxy-2-benzyloxymethyl-3,6-dihydro-2h-pyran, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2R,3S)-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran (CAS 850753-00-3) is a chemical compound with the molecular formula C20H22O3 and a molecular weight of 310.4 g/mol. IUPAC name: (2R,3S)-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran. InChIKey: KKMXQLNJHWXPDU-VQTJNVASSA-N.
| Molecular formula | C20H22O3 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | (2R,3S)-3-phenylmethoxy-2-(phenylmethoxymethyl)-3,6-dihydro-2H-pyran |
| InChIKey | KKMXQLNJHWXPDU-VQTJNVASSA-N |
| SMILES | C1C=C[C@@H]([C@H](O1)COCC2=CC=CC=C2)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)