CAS 1350468-76-6 appears in our catalog under these names: Ethinylesteradiol EP Impurity H (16-Oxo- Ethinylesteradiol), Ethinylestradiol EP Impurity H, Ethinylestradiol Impurity 8(Ethinylestradiol EP Impurity H), 16-Oxo Ethynyl Estradiol. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg.
(8R,9S,13S,14S,17R)-17-ethynyl-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-16-one (CAS 1350468-76-6) is a chemical compound with the molecular formula C20H22O3 and a molecular weight of 310.4 g/mol. IUPAC name: (8R,9S,13S,14S,17R)-17-ethynyl-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-16-one. InChIKey: ZJACPGCDLFVQMY-JOMPHRNESA-N.
| Molecular formula | C20H22O3 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | (8R,9S,13S,14S,17R)-17-ethynyl-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthren-16-one |
| InChIKey | ZJACPGCDLFVQMY-JOMPHRNESA-N |
| SMILES | C[C@]12CC[C@H]3[C@H]([C@@H]1CC(=O)[C@]2(C#C)O)CCC4=C3C=CC(=C4)O |
Computed by PubChem (NCBI)