CAS 662154-28-1 appears in our catalog under these names: [4-(3-Formyl-2,5-dimethyl-1h-pyrrol-1-yl)phenoxy]acetic acid, 95%, 2-(4-(3-Formyl-2,5-dimethyl-1H-pyrrol-1-yl)phenoxy)acetic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 2,5g.
2-[4-(3-formyl-2,5-dimethylpyrrol-1-yl)phenoxy]acetic acid (CAS 662154-28-1) is a chemical compound with the molecular formula C15H15NO4 and a molecular weight of 273.28 g/mol. IUPAC name: 2-[4-(3-formyl-2,5-dimethylpyrrol-1-yl)phenoxy]acetic acid. InChIKey: ZUJFOJPVRRGGKE-UHFFFAOYSA-N.
| Molecular formula | C15H15NO4 |
|---|---|
| Molecular weight | 273.28 g/mol |
| IUPAC name | 2-[4-(3-formyl-2,5-dimethylpyrrol-1-yl)phenoxy]acetic acid |
| InChIKey | ZUJFOJPVRRGGKE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N1C2=CC=C(C=C2)OCC(=O)O)C)C=O |
Computed by PubChem (NCBI)