CAS 105219-43-0 appears in our catalog under these names: 3,5-Difluoro-4-methoxycinnamic acid, 95%, 3,5-Difluoro-4-methoxycinnamic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
(E)-3-(3,5-difluoro-4-methoxyphenyl)prop-2-enoic acid (CAS 105219-43-0) is a chemical compound with the molecular formula C10H8F2O3 and a molecular weight of 214.16 g/mol. IUPAC name: (E)-3-(3,5-difluoro-4-methoxyphenyl)prop-2-enoic acid. InChIKey: DETUIHJOEHNQBZ-NSCUHMNNSA-N.
| Molecular formula | C10H8F2O3 |
|---|---|
| Molecular weight | 214.16 g/mol |
| IUPAC name | (E)-3-(3,5-difluoro-4-methoxyphenyl)prop-2-enoic acid |
| InChIKey | DETUIHJOEHNQBZ-NSCUHMNNSA-N |
| SMILES | COC1=C(C=C(C=C1F)/C=C/C(=O)O)F |
Computed by PubChem (NCBI)