CAS 1092460-61-1 is the registry number for 3,5-Difluoro-2-methoxycinnamic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(E)-3-(3,5-difluoro-2-methoxyphenyl)prop-2-enoic acid (CAS 1092460-61-1) is a chemical compound with the molecular formula C10H8F2O3 and a molecular weight of 214.16 g/mol. IUPAC name: (E)-3-(3,5-difluoro-2-methoxyphenyl)prop-2-enoic acid. InChIKey: LCZJSDPZIJRCKT-NSCUHMNNSA-N.
| Molecular formula | C10H8F2O3 |
|---|---|
| Molecular weight | 214.16 g/mol |
| IUPAC name | (E)-3-(3,5-difluoro-2-methoxyphenyl)prop-2-enoic acid |
| InChIKey | LCZJSDPZIJRCKT-NSCUHMNNSA-N |
| SMILES | COC1=C(C=C(C=C1F)F)/C=C/C(=O)O |
Computed by PubChem (NCBI)