Products 135132-40-0
CAS 135132-40-0 is the registry number for 1-(2,2-Difluoro-1,3-dioxaindan-5-yl)propan-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(2,2-difluoro-1,3-benzodioxol-5-yl)propan-1-one (CAS 135132-40-0) is a chemical compound with the molecular formula C10H8F2O3 and a molecular weight of 214.16 g/mol. IUPAC name: 1-(2,2-difluoro-1,3-benzodioxol-5-yl)propan-1-one. InChIKey: YPIQXQPVQNVXNL-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O3 |
|---|---|
| Molecular weight | 214.16 g/mol |
| IUPAC name | 1-(2,2-difluoro-1,3-benzodioxol-5-yl)propan-1-one |
| InChIKey | YPIQXQPVQNVXNL-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC2=C(C=C1)OC(O2)(F)F |
Computed by PubChem (NCBI)