Products 1308915-16-3
CAS 1308915-16-3 appears in our catalog under these names: 2-(4-Acetylphenyl)-2,2-difluoroacetic acid, 95%, 2-(4-Acetylphenyl)-2,2-difluoroacetic acid, 95-<97%, 2-(4-Acetylphenyl)-2,2-difluoroacetic acid, 96%, 96%, 2-(4-Acetylphenyl)-2,2-difluoroacetic acid, 96%. Offered by: Combi-blocks, Hoffman Fine Chemicals, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g, 25g, 100mg.
2-(4-acetylphenyl)-2,2-difluoroacetic acid (CAS 1308915-16-3) is a chemical compound with the molecular formula C10H8F2O3 and a molecular weight of 214.16 g/mol. IUPAC name: 2-(4-acetylphenyl)-2,2-difluoroacetic acid. InChIKey: NTEXUINTPQGRTK-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O3 |
|---|---|
| Molecular weight | 214.16 g/mol |
| IUPAC name | 2-(4-acetylphenyl)-2,2-difluoroacetic acid |
| InChIKey | NTEXUINTPQGRTK-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C(C(=O)O)(F)F |
Computed by PubChem (NCBI)