CAS 2289155-72-0 is the registry number for Methyl 3-(2,5-difluorophenyl)-2-oxopropanoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-(2,5-difluorophenyl)-2-oxopropanoate (CAS 2289155-72-0) is a chemical compound with the molecular formula C10H8F2O3 and a molecular weight of 214.16 g/mol. IUPAC name: methyl 3-(2,5-difluorophenyl)-2-oxopropanoate. InChIKey: JCZUAUHMWZBKKA-UHFFFAOYSA-N.
| Molecular formula | C10H8F2O3 |
|---|---|
| Molecular weight | 214.16 g/mol |
| IUPAC name | methyl 3-(2,5-difluorophenyl)-2-oxopropanoate |
| InChIKey | JCZUAUHMWZBKKA-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC1=C(C=CC(=C1)F)F |
Computed by PubChem (NCBI)