Products 302912-30-7

CAS 302912-30-7 is the registry number for 4-(3,5-Difluorophenyl)-4-oxobutyric acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

4-(3,5-difluorophenyl)-4-oxobutanoic acid (CAS 302912-30-7) is a chemical compound with the molecular formula C10H8F2O3 and a molecular weight of 214.16 g/mol. IUPAC name: 4-(3,5-difluorophenyl)-4-oxobutanoic acid. InChIKey: SSBFKGDYTIRSOC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H8F2O3
Molecular weight214.16 g/mol
IUPAC name4-(3,5-difluorophenyl)-4-oxobutanoic acid
InChIKeySSBFKGDYTIRSOC-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1F)F)C(=O)CCC(=O)O

Computed by PubChem (NCBI)