CAS 116133-19-8 is the registry number for N-(3-Chlorophenyl)-2-(methylamino)acetamide hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g.
N-(3-chlorophenyl)-2-(methylamino)acetamide;hydrochloride (CAS 116133-19-8) is a chemical compound with the molecular formula C9H12Cl2N2O and a molecular weight of 235.11 g/mol. IUPAC name: N-(3-chlorophenyl)-2-(methylamino)acetamide;hydrochloride. InChIKey: FMQDZEWYRMGYRH-UHFFFAOYSA-N.
| Molecular formula | C9H12Cl2N2O |
|---|---|
| Molecular weight | 235.11 g/mol |
| IUPAC name | N-(3-chlorophenyl)-2-(methylamino)acetamide;hydrochloride |
| InChIKey | FMQDZEWYRMGYRH-UHFFFAOYSA-N |
| SMILES | CNCC(=O)NC1=CC(=CC=C1)Cl.Cl |
Computed by PubChem (NCBI)