Products 1052567-31-3

CAS 1052567-31-3 appears in our catalog under these names: 1-Phenyl-pyrazole 4-pyruvic Acid, 2-Oxo-3-(1-phenyl-1H-pyrazol-4-yl)propanoic acid. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-oxo-3-(1-phenylpyrazol-4-yl)propanoic acid (CAS 1052567-31-3) is a chemical compound with the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. IUPAC name: 2-oxo-3-(1-phenylpyrazol-4-yl)propanoic acid. InChIKey: DRPATNHCBBZMLW-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10N2O3
Molecular weight230.22 g/mol
IUPAC name2-oxo-3-(1-phenylpyrazol-4-yl)propanoic acid
InChIKeyDRPATNHCBBZMLW-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)N2C=C(C=N2)CC(=O)C(=O)O

Computed by PubChem (NCBI)