CAS 105460-59-1 is the registry number for 4-tert-Butyldimethylsilyloxybenzeneacetic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 2,5g, 250mg.
Methyl 2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]acetate (CAS 105460-59-1) is a chemical compound with the molecular formula C15H24O3Si and a molecular weight of 280.43 g/mol. IUPAC name: methyl 2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]acetate. InChIKey: NKXFLJNXVFGEHZ-UHFFFAOYSA-N.
| Molecular formula | C15H24O3Si |
|---|---|
| Molecular weight | 280.43 g/mol |
| IUPAC name | methyl 2-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]acetate |
| InChIKey | NKXFLJNXVFGEHZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1=CC=C(C=C1)CC(=O)OC |
Computed by PubChem (NCBI)