CAS 2222115-55-9 appears in our catalog under these names: Methyl 4-((tert-butyldimethylsilyl)oxy)-2-methylbenzoate, 98%, methyl 4–((tert–butyldimethylsilyl)oxy)–2–methylbenzoate, methyl 4-((tert-butyldimethylsilyl)oxy)-2-methylbenzoate. Offered by: AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 1g, 250mg.
Methyl 4-[tert-butyl(dimethyl)silyl]oxy-2-methylbenzoate (CAS 2222115-55-9) is a chemical compound with the molecular formula C15H24O3Si and a molecular weight of 280.43 g/mol. IUPAC name: methyl 4-[tert-butyl(dimethyl)silyl]oxy-2-methylbenzoate. InChIKey: NJZCELPGGBPFEL-UHFFFAOYSA-N.
| Molecular formula | C15H24O3Si |
|---|---|
| Molecular weight | 280.43 g/mol |
| IUPAC name | methyl 4-[tert-butyl(dimethyl)silyl]oxy-2-methylbenzoate |
| InChIKey | NJZCELPGGBPFEL-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)O[Si](C)(C)C(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)