CAS 153025-65-1 appears in our catalog under these names: Ethyl 4-((tert-butyldimethylsilyl)oxy)benzoate, 95%, Ethyl 4–((tert–butyldimethylsilyl)oxy)benzoate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 5g, 100mg.
Ethyl 4-[tert-butyl(dimethyl)silyl]oxybenzoate (CAS 153025-65-1) is a chemical compound with the molecular formula C15H24O3Si and a molecular weight of 280.43 g/mol. IUPAC name: ethyl 4-[tert-butyl(dimethyl)silyl]oxybenzoate. InChIKey: ZJJMIOGRUQQIQZ-UHFFFAOYSA-N.
| Molecular formula | C15H24O3Si |
|---|---|
| Molecular weight | 280.43 g/mol |
| IUPAC name | ethyl 4-[tert-butyl(dimethyl)silyl]oxybenzoate |
| InChIKey | ZJJMIOGRUQQIQZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)O[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)