CAS 615561-38-1 is the registry number for 3-(((tert-Butyldimethylsilyl)oxy)methyl)-5-methylbenzoic Acid. Offered by: TRC. Available pack sizes: 500mg.
3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methylbenzoic acid (CAS 615561-38-1) is a chemical compound with the molecular formula C15H24O3Si and a molecular weight of 280.43 g/mol. IUPAC name: 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methylbenzoic acid. InChIKey: DXSDQZUVVHAWRL-UHFFFAOYSA-N.
| Molecular formula | C15H24O3Si |
|---|---|
| Molecular weight | 280.43 g/mol |
| IUPAC name | 3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methylbenzoic acid |
| InChIKey | DXSDQZUVVHAWRL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)O)CO[Si](C)(C)C(C)(C)C |
Computed by PubChem (NCBI)