CAS 115118-86-0 is the registry number for ((tert-Butyldimethylsilyl)oxy)(phenyl)methyl acetate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl 2-[tert-butyl(dimethyl)silyl]oxyacetate (CAS 115118-86-0) is a chemical compound with the molecular formula C15H24O3Si and a molecular weight of 280.43 g/mol. IUPAC name: benzyl 2-[tert-butyl(dimethyl)silyl]oxyacetate. InChIKey: ABGDWMZAJFMSJR-UHFFFAOYSA-N.
| Molecular formula | C15H24O3Si |
|---|---|
| Molecular weight | 280.43 g/mol |
| IUPAC name | benzyl 2-[tert-butyl(dimethyl)silyl]oxyacetate |
| InChIKey | ABGDWMZAJFMSJR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)