Products 115118-86-0

CAS 115118-86-0 is the registry number for ((tert-Butyldimethylsilyl)oxy)(phenyl)methyl acetate, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Benzyl 2-[tert-butyl(dimethyl)silyl]oxyacetate (CAS 115118-86-0) is a chemical compound with the molecular formula C15H24O3Si and a molecular weight of 280.43 g/mol. IUPAC name: benzyl 2-[tert-butyl(dimethyl)silyl]oxyacetate. InChIKey: ABGDWMZAJFMSJR-UHFFFAOYSA-N.

Identity
Molecular formulaC15H24O3Si
Molecular weight280.43 g/mol
IUPAC namebenzyl 2-[tert-butyl(dimethyl)silyl]oxyacetate
InChIKeyABGDWMZAJFMSJR-UHFFFAOYSA-N
SMILESCC(C)(C)[Si](C)(C)OCC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)