CAS 886363-54-8 appears in our catalog under these names: [4-(tert-Butyl-dimethyl-silanyloxymethyl)phenyl]-acetic acid, 95%, 2-(4-(((tert-Butyldimethylsilyl)oxy)methyl)phenyl)acetic acid, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]acetic acid (CAS 886363-54-8) is a chemical compound with the molecular formula C15H24O3Si and a molecular weight of 280.43 g/mol. IUPAC name: 2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]acetic acid. InChIKey: XQWYZOLEWPQRES-UHFFFAOYSA-N.
| Molecular formula | C15H24O3Si |
|---|---|
| Molecular weight | 280.43 g/mol |
| IUPAC name | 2-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]acetic acid |
| InChIKey | XQWYZOLEWPQRES-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=CC=C(C=C1)CC(=O)O |
Computed by PubChem (NCBI)