CAS 1055035-48-7 is the registry number for 2-Amino-6-chloro-9-(3-deoxy-beta-D-ribofuanosyl)-9H-purine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3R,5S)-2-(2-amino-6-chloropurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol (CAS 1055035-48-7) is a chemical compound with the molecular formula C10H12ClN5O3 and a molecular weight of 285.69 g/mol. IUPAC name: (2R,3R,5S)-2-(2-amino-6-chloropurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol. InChIKey: CBXLNNNWHUKXSN-OBXARNEKSA-N.
| Molecular formula | C10H12ClN5O3 |
|---|---|
| Molecular weight | 285.69 g/mol |
| IUPAC name | (2R,3R,5S)-2-(2-amino-6-chloropurin-9-yl)-5-(hydroxymethyl)oxolan-3-ol |
| InChIKey | CBXLNNNWHUKXSN-OBXARNEKSA-N |
| SMILES | C1[C@H](O[C@H]([C@@H]1O)N2C=NC3=C2N=C(N=C3Cl)N)CO |
Computed by PubChem (NCBI)