Products 81777-48-2

CAS 81777-48-2 is the registry number for 6-Chloro Acyclovir Acetate. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

2-[(2-amino-6-chloropurin-9-yl)methoxy]ethyl acetate (CAS 81777-48-2) is a chemical compound with the molecular formula C10H12ClN5O3 and a molecular weight of 285.69 g/mol. IUPAC name: 2-[(2-amino-6-chloropurin-9-yl)methoxy]ethyl acetate. InChIKey: RAEGIEVTUAVTJO-UHFFFAOYSA-N.

Identity
Molecular formulaC10H12ClN5O3
Molecular weight285.69 g/mol
IUPAC name2-[(2-amino-6-chloropurin-9-yl)methoxy]ethyl acetate
InChIKeyRAEGIEVTUAVTJO-UHFFFAOYSA-N
SMILESCC(=O)OCCOCN1C=NC2=C1N=C(N=C2Cl)N

Computed by PubChem (NCBI)