CAS 5542-92-7 appears in our catalog under these names: Cladribine EP Impurity D, 1’-epi-Cladribine, >95% (HPLC), Cladribine Impurity D. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 100mg, 2mg, 1mg, 5mg, 25mg, 10mg.
(2R,3S,5S)-5-(6-amino-2-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol (CAS 5542-92-7) is a chemical compound with the molecular formula C10H12ClN5O3 and a molecular weight of 285.69 g/mol. IUPAC name: (2R,3S,5S)-5-(6-amino-2-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol. InChIKey: PTOAARAWEBMLNO-JKUQZMGJSA-N.
| Molecular formula | C10H12ClN5O3 |
|---|---|
| Molecular weight | 285.69 g/mol |
| IUPAC name | (2R,3S,5S)-5-(6-amino-2-chloropurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | PTOAARAWEBMLNO-JKUQZMGJSA-N |
| SMILES | C1[C@@H]([C@H](O[C@@H]1N2C=NC3=C(N=C(N=C32)Cl)N)CO)O |
Computed by PubChem (NCBI)