Products 2627-62-5
CAS 2627-62-5 appears in our catalog under these names: 2'–Chloro–2'–deoxyadenosine, 2’-Chloro-2’-deoxyadenosine, 2’-Chloro-2’-deoxyadenosine, 98.53%. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 20mg, 50 mg, 25 mg, 10 mg, 5 mg.
(2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-chloro-2-(hydroxymethyl)oxolan-3-ol (CAS 2627-62-5) is a chemical compound with the molecular formula C10H12ClN5O3 and a molecular weight of 285.69 g/mol. IUPAC name: (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-chloro-2-(hydroxymethyl)oxolan-3-ol. InChIKey: ADXUXRNLBYKGOA-QYYRPYCUSA-N.
| Molecular formula | C10H12ClN5O3 |
|---|---|
| Molecular weight | 285.69 g/mol |
| IUPAC name | (2R,3R,4R,5R)-5-(6-aminopurin-9-yl)-4-chloro-2-(hydroxymethyl)oxolan-3-ol |
| InChIKey | ADXUXRNLBYKGOA-QYYRPYCUSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)Cl)N |
Computed by PubChem (NCBI)