Products 1432019-27-6
CAS 1432019-27-6 is the registry number for 5’-Deshydroxy 5’-Chloro L-Adenosine. Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 5mg.
(2S,3S,4R,5R)-2-(6-aminopurin-9-yl)-5-(chloromethyl)oxolane-3,4-diol (CAS 1432019-27-6) is a chemical compound with the molecular formula C10H12ClN5O3 and a molecular weight of 285.69 g/mol. IUPAC name: (2S,3S,4R,5R)-2-(6-aminopurin-9-yl)-5-(chloromethyl)oxolane-3,4-diol. InChIKey: IYSNPOMTKFZDHZ-DEGSGYPDSA-N.
| Molecular formula | C10H12ClN5O3 |
|---|---|
| Molecular weight | 285.69 g/mol |
| IUPAC name | (2S,3S,4R,5R)-2-(6-aminopurin-9-yl)-5-(chloromethyl)oxolane-3,4-diol |
| InChIKey | IYSNPOMTKFZDHZ-DEGSGYPDSA-N |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)[C@@H]3[C@H]([C@H]([C@@H](O3)CCl)O)O)N |
Computed by PubChem (NCBI)
Synonyms:
5'-Deshydroxy 5'-Chloro L-Adenosine