CAS 1055321-78-2 is the registry number for 5-Chloro-1,2-dihydro-1-acenaphthylenol. Offered by: TRC. Available pack sizes: 250mg, 25mg.
5-chloro-1,2-dihydroacenaphthylen-1-ol (CAS 1055321-78-2) is a chemical compound with the molecular formula C12H9ClO and a molecular weight of 204.65 g/mol. IUPAC name: 5-chloro-1,2-dihydroacenaphthylen-1-ol. InChIKey: SDQDVVZXKQGJTD-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 5-chloro-1,2-dihydroacenaphthylen-1-ol |
| InChIKey | SDQDVVZXKQGJTD-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC=CC3=C(C=CC1=C32)Cl)O |
Computed by PubChem (NCBI)