Products 105560-99-4

CAS 105560-99-4 is the registry number for Methyl 2-amino-3-(1H-pyrazol-1-yl)propanoate dihydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

Methyl 2-amino-3-pyrazol-1-ylpropanoate;dihydrochloride (CAS 105560-99-4) is a chemical compound with the molecular formula C7H13Cl2N3O2 and a molecular weight of 242.10 g/mol. IUPAC name: methyl 2-amino-3-pyrazol-1-ylpropanoate;dihydrochloride. InChIKey: VYJYVKKLRJEMQI-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13Cl2N3O2
Molecular weight242.10 g/mol
IUPAC namemethyl 2-amino-3-pyrazol-1-ylpropanoate;dihydrochloride
InChIKeyVYJYVKKLRJEMQI-UHFFFAOYSA-N
SMILESCOC(=O)C(CN1C=CC=N1)N.Cl.Cl

Computed by PubChem (NCBI)