Products 2169997-54-8

CAS 2169997-54-8 is the registry number for Ethyl (4-amino-1h-pyrazol-1-yl)acetate dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 250mg, 5g.

Structural formula: {0} (CAS {1})

Ethyl 2-(4-aminopyrazol-1-yl)acetate;dihydrochloride (CAS 2169997-54-8) is a chemical compound with the molecular formula C7H13Cl2N3O2 and a molecular weight of 242.10 g/mol. IUPAC name: ethyl 2-(4-aminopyrazol-1-yl)acetate;dihydrochloride. InChIKey: IONZTCAFMJOAOX-UHFFFAOYSA-N.

Identity
Molecular formulaC7H13Cl2N3O2
Molecular weight242.10 g/mol
IUPAC nameethyl 2-(4-aminopyrazol-1-yl)acetate;dihydrochloride
InChIKeyIONZTCAFMJOAOX-UHFFFAOYSA-N
SMILESCCOC(=O)CN1C=C(C=N1)N.Cl.Cl

Computed by PubChem (NCBI)