CAS 2169997-54-8 is the registry number for Ethyl (4-amino-1h-pyrazol-1-yl)acetate dihydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 250mg, 5g.
Ethyl 2-(4-aminopyrazol-1-yl)acetate;dihydrochloride (CAS 2169997-54-8) is a chemical compound with the molecular formula C7H13Cl2N3O2 and a molecular weight of 242.10 g/mol. IUPAC name: ethyl 2-(4-aminopyrazol-1-yl)acetate;dihydrochloride. InChIKey: IONZTCAFMJOAOX-UHFFFAOYSA-N.
| Molecular formula | C7H13Cl2N3O2 |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | ethyl 2-(4-aminopyrazol-1-yl)acetate;dihydrochloride |
| InChIKey | IONZTCAFMJOAOX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C=C(C=N1)N.Cl.Cl |
Computed by PubChem (NCBI)