CAS 56216-28-5 appears in our catalog under these names: 2,6-Dimethoxypyridine-3,5-diamine hydrochloride, 95%, 2,6-Dimethoxypyridine-3,5-diamine dihydrochloride, 97%, 2,6-Dimethoxypyridine-3,5-diamine Dihydrochloride (>90%), 2,6-dimethoxypyridine-3,5-diamine. Offered by: Combi-blocks, Chemat Brand, TRC. Available pack sizes: 5g, 25g, 1g, on request, 100mg, 500mg, 50mg.
2,6-dimethoxypyridine-3,5-diamine;dihydrochloride (CAS 56216-28-5) is a chemical compound with the molecular formula C7H13Cl2N3O2 and a molecular weight of 242.10 g/mol. IUPAC name: 2,6-dimethoxypyridine-3,5-diamine;dihydrochloride. InChIKey: WHKIQFYYHZPIBH-UHFFFAOYSA-N.
| Molecular formula | C7H13Cl2N3O2 |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 2,6-dimethoxypyridine-3,5-diamine;dihydrochloride |
| InChIKey | WHKIQFYYHZPIBH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=N1)OC)N)N.Cl.Cl |
Computed by PubChem (NCBI)