CAS 32381-18-3 appears in our catalog under these names: Alpha-methyl-dl-histidine dihydrochloride, 95%, 2-Amino-3-(1H-imidazol-4-yl)-2-methylpropanoic acid dihydrochloride, 97%, H–α–Me–DL–His–OH · 2 HCl, DL-alpha-Methylhistidine dihydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth. Available pack sizes: 100mg, 250mg, 1g, 25mg, 50mg, 500mg.
2-amino-3-(1H-imidazol-5-yl)-2-methylpropanoic acid;dihydrochloride (CAS 32381-18-3) is a chemical compound with the molecular formula C7H13Cl2N3O2 and a molecular weight of 242.10 g/mol. IUPAC name: 2-amino-3-(1H-imidazol-5-yl)-2-methylpropanoic acid;dihydrochloride. InChIKey: YWVHQKZLHBDZLG-UHFFFAOYSA-N.
| Molecular formula | C7H13Cl2N3O2 |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 2-amino-3-(1H-imidazol-5-yl)-2-methylpropanoic acid;dihydrochloride |
| InChIKey | YWVHQKZLHBDZLG-UHFFFAOYSA-N |
| SMILES | CC(CC1=CN=CN1)(C(=O)O)N.Cl.Cl |
Computed by PubChem (NCBI)