CAS 1423027-89-7 appears in our catalog under these names: 2-(2-Aminoethyl)-5-methyl-1,4,5,6-tetrahydropyrimidine-4,6-dione dihydrochloride, 98%, 2-(2-Aminoethyl)-5-methyl-1,4,5,6-tetrahydropyrimidine-4,6-dione dihydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 50mg, 0,5g.
2-(2-aminoethyl)-5-methyl-1H-pyrimidine-4,6-dione;dihydrochloride (CAS 1423027-89-7) is a chemical compound with the molecular formula C7H13Cl2N3O2 and a molecular weight of 242.10 g/mol. IUPAC name: 2-(2-aminoethyl)-5-methyl-1H-pyrimidine-4,6-dione;dihydrochloride. InChIKey: RYDNPCAZOYQWTB-UHFFFAOYSA-N.
| Molecular formula | C7H13Cl2N3O2 |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | 2-(2-aminoethyl)-5-methyl-1H-pyrimidine-4,6-dione;dihydrochloride |
| InChIKey | RYDNPCAZOYQWTB-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NC(=NC1=O)CCN.Cl.Cl |
Computed by PubChem (NCBI)