CAS 1607247-41-5 appears in our catalog under these names: Methyl 2-amino-3-(1h-imidazol-1-yl)propanoate dihydrochloride, 95%, Methyl 2-amino-3-(1H-imidazol-1-yl)propanoate dihydrochloride. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 2,5g.
Methyl 2-amino-3-imidazol-1-ylpropanoate;dihydrochloride (CAS 1607247-41-5) is a chemical compound with the molecular formula C7H13Cl2N3O2 and a molecular weight of 242.10 g/mol. IUPAC name: methyl 2-amino-3-imidazol-1-ylpropanoate;dihydrochloride. InChIKey: LSMCHVKPQFDGSY-UHFFFAOYSA-N.
| Molecular formula | C7H13Cl2N3O2 |
|---|---|
| Molecular weight | 242.10 g/mol |
| IUPAC name | methyl 2-amino-3-imidazol-1-ylpropanoate;dihydrochloride |
| InChIKey | LSMCHVKPQFDGSY-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CN1C=CN=C1)N.Cl.Cl |
Computed by PubChem (NCBI)