CAS 10557-13-8 appears in our catalog under these names: 1-[4-(Trifluoromethyl)phenyl]propane-1,2-dione, 95%, 1-(4-Trifluoromethylphenyl)-1,2-propanedione, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 10g, 25g.
1-[4-(trifluoromethyl)phenyl]propane-1,2-dione (CAS 10557-13-8) is a chemical compound with the molecular formula C10H7F3O2 and a molecular weight of 216.16 g/mol. IUPAC name: 1-[4-(trifluoromethyl)phenyl]propane-1,2-dione. InChIKey: FAKCECCBNBDCNE-UHFFFAOYSA-N.
| Molecular formula | C10H7F3O2 |
|---|---|
| Molecular weight | 216.16 g/mol |
| IUPAC name | 1-[4-(trifluoromethyl)phenyl]propane-1,2-dione |
| InChIKey | FAKCECCBNBDCNE-UHFFFAOYSA-N |
| SMILES | CC(=O)C(=O)C1=CC=C(C=C1)C(F)(F)F |
Computed by PubChem (NCBI)