CAS 185388-85-6 appears in our catalog under these names: 6-(Trifluoromethoxy)-2,3-dihydro-1h-inden-1-one, 95%, 6–(Trifluoromethoxy)–2,3–dihydro–1H–inden–1–one, 2,3-Dihydro-6-(trifluoroMethoxy)-1H-inden-1-one, 6-(Trifluoromethoxy)-2,3-dihydro-1H-inden-1-one 97%, 6-(Trifluoromethoxy)-2,3-dihydro-1H-inden-1-one, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 100mg.
6-(trifluoromethoxy)-2,3-dihydroinden-1-one (CAS 185388-85-6) is a chemical compound with the molecular formula C10H7F3O2 and a molecular weight of 216.16 g/mol. IUPAC name: 6-(trifluoromethoxy)-2,3-dihydroinden-1-one. InChIKey: USUMKWGNHPAWFX-UHFFFAOYSA-N.
| Molecular formula | C10H7F3O2 |
|---|---|
| Molecular weight | 216.16 g/mol |
| IUPAC name | 6-(trifluoromethoxy)-2,3-dihydroinden-1-one |
| InChIKey | USUMKWGNHPAWFX-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=CC(=C2)OC(F)(F)F |
Computed by PubChem (NCBI)