CAS 186425-80-9 appears in our catalog under these names: 3-Phenyl-2-(trifluoromethyl)prop-2-enoic acid, 95%, 3-Phenyl-2-(trifluoromethyl)prop-2-enoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 100mg, 250mg.
(Z)-3-phenyl-2-(trifluoromethyl)prop-2-enoic acid (CAS 186425-80-9) is a chemical compound with the molecular formula C10H7F3O2 and a molecular weight of 216.16 g/mol. IUPAC name: (Z)-3-phenyl-2-(trifluoromethyl)prop-2-enoic acid. InChIKey: JLTJGTZUUSSVMZ-VURMDHGXSA-N.
| Molecular formula | C10H7F3O2 |
|---|---|
| Molecular weight | 216.16 g/mol |
| IUPAC name | (Z)-3-phenyl-2-(trifluoromethyl)prop-2-enoic acid |
| InChIKey | JLTJGTZUUSSVMZ-VURMDHGXSA-N |
| SMILES | C1=CC=C(C=C1)/C=C(/C(=O)O)\C(F)(F)F |
Computed by PubChem (NCBI)