CAS 86988-49-0 appears in our catalog under these names: 1-(4-Acetylphenyl)-2,2,2-trifluoroethanone, 95%, 1-(4-Acetylphenyl)-2,2,2-trifluoroethanone 97%, 1-(4-Acetylphenyl)-2,2,2-trifluoroethanone, 97%, 97%, 1-(4-Acetylphenyl)-2,2,2-trifluoroethan-1-one, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
1-(4-acetylphenyl)-2,2,2-trifluoroethanone (CAS 86988-49-0) is a chemical compound with the molecular formula C10H7F3O2 and a molecular weight of 216.16 g/mol. IUPAC name: 1-(4-acetylphenyl)-2,2,2-trifluoroethanone. InChIKey: FCHCYEDIAATYDX-UHFFFAOYSA-N.
| Molecular formula | C10H7F3O2 |
|---|---|
| Molecular weight | 216.16 g/mol |
| IUPAC name | 1-(4-acetylphenyl)-2,2,2-trifluoroethanone |
| InChIKey | FCHCYEDIAATYDX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)