CAS 173252-76-1 appears in our catalog under these names: 5-Trifluoromethoxyindan-1-one, 5–(Trifluoromethoxy)–2,3–dihydro–1H–inden–1–one, 5-(Trifluoromethoxy)-2,3-dihydro-1h-inden-1-one, 95%, 5-(Trifluoromethoxy)-2,3-dihydro-1H-inden-1-one, 98%. Offered by: TRC, GLPBio, Combi-blocks, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
5-(trifluoromethoxy)-2,3-dihydroinden-1-one (CAS 173252-76-1) is a chemical compound with the molecular formula C10H7F3O2 and a molecular weight of 216.16 g/mol. IUPAC name: 5-(trifluoromethoxy)-2,3-dihydroinden-1-one. InChIKey: DJGOAKVCWWDUHQ-UHFFFAOYSA-N.
| Molecular formula | C10H7F3O2 |
|---|---|
| Molecular weight | 216.16 g/mol |
| IUPAC name | 5-(trifluoromethoxy)-2,3-dihydroinden-1-one |
| InChIKey | DJGOAKVCWWDUHQ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C=C(C=C2)OC(F)(F)F |
Computed by PubChem (NCBI)