CAS 2143-93-3 appears in our catalog under these names: 4,4,4-Trifluoro-3-phenylbut-2-enoic acid, 95%, (E)-4,4,4-Trifluoro-3-phenylbut-2-enoic acid, (Z)-4,4,4-Trifluoro-3-phenylbut-2-enoic acid, 95+%. Offered by: Combi-blocks, Chemat, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4,4,4-trifluoro-3-phenylbut-2-enoic acid (CAS 2143-93-3) is a chemical compound with the molecular formula C10H7F3O2 and a molecular weight of 216.16 g/mol. IUPAC name: 4,4,4-trifluoro-3-phenylbut-2-enoic acid. InChIKey: IZLDRXUDBMVNKB-UHFFFAOYSA-N.
| Molecular formula | C10H7F3O2 |
|---|---|
| Molecular weight | 216.16 g/mol |
| IUPAC name | 4,4,4-trifluoro-3-phenylbut-2-enoic acid |
| InChIKey | IZLDRXUDBMVNKB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=CC(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)