CAS 105627-80-3 appears in our catalog under these names: Fasudil Impurity 32, 1-Chloro-5-isoquinolinesulfonic Acid, 1-Chloroisoquinoline-5-sulfonic acid, 95%, 95%. Offered by: Chemat Brand, TRC, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g.
1-chloroisoquinoline-5-sulfonic acid (CAS 105627-80-3) is a chemical compound with the molecular formula C9H6ClNO3S and a molecular weight of 243.67 g/mol. IUPAC name: 1-chloroisoquinoline-5-sulfonic acid. InChIKey: FGQPVNODELDKQF-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO3S |
|---|---|
| Molecular weight | 243.67 g/mol |
| IUPAC name | 1-chloroisoquinoline-5-sulfonic acid |
| InChIKey | FGQPVNODELDKQF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2Cl)C(=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)