CAS 1246816-17-0 is the registry number for 8-Chloro-5-isoquinolinesulfonic Acid. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg, 0,5g, 50mg.
8-chloroisoquinoline-5-sulfonic acid (CAS 1246816-17-0) is a chemical compound with the molecular formula C9H6ClNO3S and a molecular weight of 243.67 g/mol. IUPAC name: 8-chloroisoquinoline-5-sulfonic acid. InChIKey: LNDJWBVKJWGPQK-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO3S |
|---|---|
| Molecular weight | 243.67 g/mol |
| IUPAC name | 8-chloroisoquinoline-5-sulfonic acid |
| InChIKey | LNDJWBVKJWGPQK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C=NC=CC2=C1S(=O)(=O)O)Cl |
Computed by PubChem (NCBI)