Products 1246816-17-0

CAS 1246816-17-0 is the registry number for 8-Chloro-5-isoquinolinesulfonic Acid. Offered by: TRC, Biosynth. Available pack sizes: 250mg, 25mg, 0,5g, 50mg.

Structural formula: {0} (CAS {1})

8-chloroisoquinoline-5-sulfonic acid (CAS 1246816-17-0) is a chemical compound with the molecular formula C9H6ClNO3S and a molecular weight of 243.67 g/mol. IUPAC name: 8-chloroisoquinoline-5-sulfonic acid. InChIKey: LNDJWBVKJWGPQK-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6ClNO3S
Molecular weight243.67 g/mol
IUPAC name8-chloroisoquinoline-5-sulfonic acid
InChIKeyLNDJWBVKJWGPQK-UHFFFAOYSA-N
SMILESC1=CC(=C2C=NC=CC2=C1S(=O)(=O)O)Cl

Computed by PubChem (NCBI)